Caledonite
Cu2Pb5(SO4)3(CO3)(OH)6IMA symbol: Cdograndfathered
Caledonite is a sulfate mineral with the formula Cu2Pb5(SO4)3(CO3)(OH)6, crystallizing in the orthorhombic system. It has a Mohs hardness of 2.5-3, typically green in color, with a resinous luster, a specific gravity of 6.4. Its streak is white or green.
Photos




Crystallography
| Crystal system | orthorhombic crystal systemWikidata (CC0) |
|---|---|
| Space group | P m n 21 |
| Cell (Å, °) | a = 20.085, b = 7.141, c = 6.563; α = 90, β = 90, γ = 90 |
| Cell volume | 941.311 ų, Z = 2 |
| Axial ratios | 2.8126:1:0.9191calculated from COD 9013793 |
| Source structure | COD 9013793 (The Canadian Mineralogist, 2009) — 1 of 2 structures |
Powder X-ray diffraction (calculated)
| d (Å) | 3.136 | 4.687 | 3.031 | 3.281 | 2.752 | 2.273 |
|---|---|---|---|---|---|---|
| I/I₀ | 100 | 89.4 | 61.7 | 47.4 | 43.8 | 40.6 |
xrd-v1: CuKa1 1.5406A, 2theta 5-90, top10, Imax=100, no DW/PO. Computed from COD 9013793; idealized occupancies, no preferred orientation.
Physical properties
| Density (calculated) | 5.692 g/cm³calculated from COD 9013793 |
|---|---|
| Hardness (Mohs) | 2.5-3single sourceDana, System of Mineralogy, 6th ed. (1892) |
| Specific gravity | 6.4 g/cm3single sourceDana, System of Mineralogy, 6th ed. (1892) |
| Color | greensingle sourceDana, System of Mineralogy, 6th ed. (1892) |
| Streak | green, whitesingle sourceDana, System of Mineralogy, 6th ed. (1892) |
| Luster | resinoussingle sourceDana, System of Mineralogy, 6th ed. (1892) |
Chemistry (calculated)
| Molecular weight | 1613.33 g/molcalculated from the IMA formula |
|---|---|
| Composition (wt%) | Cu 7.88%, Pb 64.21%, S 5.96%, O 20.83%, C 0.74%, H 0.37% |
Classification
| Nickel-Strunz (10th) | 7.BC.50Wikidata (CC0) |
|---|---|
| Nickel-Strunz (9th) | 7.BC.50Wikidata (CC0) |