Epidote
Ca2(Al2Fe3+)[Si2O7][SiO4]O(OH)IMA symbol: Epgrandfathered
Epidote is a silicate mineral with the formula Ca2(Al2Fe3+)[Si2O7][SiO4]O(OH), crystallizing in the monoclinic system. It has typically white in color, with a pearly luster, a specific gravity of 1.997.
Photos
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
Crystallography
| Crystal system | monoclinic crystal systemWikidata (CC0) |
|---|---|
| Space group | P 1 21/m 1 |
| Cell (Å, °) | a = 8.8817, b = 5.6543, c = 10.163; α = 90, β = 115.435, γ = 90 |
| Cell volume | 460.914 ų, Z = 2 |
| Axial ratios | 1.5708:1:1.7974calculated from COD 9014101 |
| Source structure | COD 9014101 (American Mineralogist, 2010) — 1 of 9 structures |
Physical properties
| Density (calculated) | 3.454 g/cm³calculated from COD 9014101 |
|---|---|
| Specific gravity | 1.997 g/cm3single sourceDana's System, 1st Appendix (1899) |
| Color | whitesingle sourceDana's System, 1st Appendix (1899) |
| Luster | pearlysingle sourceDana's System, 1st Appendix (1899) |
Classification
| Nickel-Strunz (10th) | 9.BG.05aWikidata (CC0) |
|---|---|
| Nickel-Strunz (9th) | 9.BG.05aWikidata (CC0) |
| Dana (8th) | 58.2.1a.7Wikidata (CC0) |