Iranite
CuPb10(CrO4)6(SiO4)2(OH)2IMA symbol: Irnapproved
Iranite is a sulfate mineral with the formula CuPb10(CrO4)6(SiO4)2(OH)2, crystallizing in the triclinic system. It has a calculated density of 6.488 g/cm3. Its streak is yellow.
Photos
Crystallography
| Crystal system | triclinic crystal systemWikidata (CC0) |
|---|---|
| Space group | P -1 |
| Cell (Å, °) | a = 9.5416, b = 11.3992, c = 10.7465; α = 120.472, β = 92.47, γ = 55.531 |
| Cell volume | 780.08 ų, Z = 1 |
| Axial ratios | 0.8370:1:0.9427calculated from COD 2016341 |
| Source structure | COD 2016341 (Acta Crystallographica Section C, 2007) |
Physical properties
| Density (calculated) | 6.488 g/cm³calculated from COD 2016341 |
|---|---|
| Streak | yellowsingle sourceWikidata (CC0) |
Chemistry (calculated)
| Molecular weight | 3049.69 g/molcalculated from the IMA formula |
|---|---|
| Composition (wt%) | Cu 2.08%, Pb 67.94%, Cr 10.23%, O 17.84%, Si 1.84%, H 0.07% |
Classification
| Nickel-Strunz (10th) | 7.FC.15Wikidata (CC0) |
|---|---|
| Nickel-Strunz (9th) | 7.FC.15Wikidata (CC0) |
| Dana (8th) | 36.1.1.1Wikidata (CC0) |