Putnisite
SrCa4Cr3+8(CO3)8(SO4)(OH)16·25H2OIMA symbol: Pniapproved
Putnisite is a mineral with the formula SrCa4Cr3+8(CO3)8(SO4)(OH)16·25H2O, crystallizing in the orthorhombic system. It has a calculated density of 2.235 g/cm3. Its streak is pink.
Photos
Crystallography
| Crystal system | orthorhombic crystal systemWikidata (CC0) |
|---|---|
| Space group | P n m a |
| Cell (Å, °) | a = 15.351, b = 20.421, c = 18.27; α = 90, β = 90, γ = 90 |
| Cell volume | 5727.33 ų, Z = 4 |
| Axial ratios | 0.7517:1:0.8947calculated from COD 9017639 |
| Source structure | COD 9017639 (Mineralogical Magazine, 2014) |
Powder X-ray diffraction (calculated)
| d (Å) | 13.616 | 7.676 | 6.686 | 3.694 | 4.906 | 5.093 |
|---|---|---|---|---|---|---|
| I/I₀ | 100 | 73.3 | 37.7 | 15.3 | 14.4 | 13.2 |
xrd-v1: CuKa1 1.5406A, 2theta 5-90, top10, Imax=100, no DW/PO. Computed from COD 9017639; idealized occupancies, no preferred orientation.
Physical properties
| Density (calculated) | 2.235 g/cm³calculated from COD 9017639 |
|---|---|
| Streak | pinksingle sourceWikidata (CC0) |